CAS 6398-06-7 appears in our catalog under these names: Z-Glu-nh2, 97%, Z-Glu-NH2, (S)-5-Amino-4-(((benzyloxy)carbonyl)amino)-5-oxopentanoic acid, 97%, Z–Glu–nh2, Z–Glu–NH₂. Offered by: Combi-blocks, Creative Peptides, AmBeed, GLPBio. Available pack sizes: 10g, 25g, 1g, 5g.
(4S)-5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid (CAS 6398-06-7) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: (4S)-5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: NHFBOIIKTDKSRE-JTQLQIEISA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | (4S)-5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | NHFBOIIKTDKSRE-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCC(=O)O)C(=O)N |
Computed by PubChem (NCBI)