CAS 175203-19-7 is the registry number for 1-(2-Bromo-4,6-difluorophenoxy)-2-chloroethane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-bromo-2-(2-chloroethoxy)-3,5-difluorobenzene (CAS 175203-19-7) is a chemical compound with the molecular formula C8H6BrClF2O and a molecular weight of 271.48 g/mol. IUPAC name: 1-bromo-2-(2-chloroethoxy)-3,5-difluorobenzene. InChIKey: QRNJNYWUYRMEPW-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClF2O |
|---|---|
| Molecular weight | 271.48 g/mol |
| IUPAC name | 1-bromo-2-(2-chloroethoxy)-3,5-difluorobenzene |
| InChIKey | QRNJNYWUYRMEPW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OCCCl)Br)F |
Computed by PubChem (NCBI)