Products 1823998-15-7
CAS 1823998-15-7 appears in our catalog under these names: 2–(4–bromo–2–chlorophenyl)–2，2–difluoroethan–1–ol, 2-(4-bromo-2-chlorophenyl)-2，2-difluoroethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2-(4-bromo-2-chlorophenyl)-2,2-difluoroethanol (CAS 1823998-15-7) is a chemical compound with the molecular formula C8H6BrClF2O and a molecular weight of 271.48 g/mol. IUPAC name: 2-(4-bromo-2-chlorophenyl)-2,2-difluoroethanol. InChIKey: NZNMSNWGMJAMKW-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClF2O |
|---|---|
| Molecular weight | 271.48 g/mol |
| IUPAC name | 2-(4-bromo-2-chlorophenyl)-2,2-difluoroethanol |
| InChIKey | NZNMSNWGMJAMKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)C(CO)(F)F |
Computed by PubChem (NCBI)