CAS 2357050-84-9 is the registry number for 2-(3-Bromo-2-chlorophenyl)-2,2-difluoroethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-bromo-2-chlorophenyl)-2,2-difluoroethanol (CAS 2357050-84-9) is a chemical compound with the molecular formula C8H6BrClF2O and a molecular weight of 271.48 g/mol. IUPAC name: 2-(3-bromo-2-chlorophenyl)-2,2-difluoroethanol. InChIKey: ZZMOZWJKVGHRSC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClF2O |
|---|---|
| Molecular weight | 271.48 g/mol |
| IUPAC name | 2-(3-bromo-2-chlorophenyl)-2,2-difluoroethanol |
| InChIKey | ZZMOZWJKVGHRSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)Cl)C(CO)(F)F |
Computed by PubChem (NCBI)