Products 175276-69-4
CAS 175276-69-4 is the registry number for Ethyl 2-methyl-5-(4-nitrophenyl)furan-3-carboxylate, 95%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g.
Ethyl 2-methyl-5-(4-nitrophenyl)furan-3-carboxylate (CAS 175276-69-4) is a chemical compound with the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. IUPAC name: ethyl 2-methyl-5-(4-nitrophenyl)furan-3-carboxylate. InChIKey: ZOFJPHGCPKKPJE-UHFFFAOYSA-N.
| Molecular formula | C14H13NO5 |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | ethyl 2-methyl-5-(4-nitrophenyl)furan-3-carboxylate |
| InChIKey | ZOFJPHGCPKKPJE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=C1)C2=CC=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)