Products 175277-25-5
CAS 175277-25-5 appears in our catalog under these names: 3-(Pyrimidin-2-ylthio)pentane-2,4-dione, 97%, 97%, 4-hydroxy-3-(pyrimidin-2-ylsulfanyl)pent-3-en-2-one, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
3-pyrimidin-2-ylsulfanylpentane-2,4-dione (CAS 175277-25-5) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 3-pyrimidin-2-ylsulfanylpentane-2,4-dione. InChIKey: PFADKNBSIBFUDF-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 3-pyrimidin-2-ylsulfanylpentane-2,4-dione |
| InChIKey | PFADKNBSIBFUDF-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(=O)C)SC1=NC=CC=N1 |
Computed by PubChem (NCBI)