Products 17537-32-5

CAS 17537-32-5 is the registry number for (±)-1-Phenylethan-2,2,2-d3-ol, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

2,2,2-trideuterio-1-phenylethanol (CAS 17537-32-5) is a chemical compound with the molecular formula C8H10O and a molecular weight of 125.18 g/mol. IUPAC name: 2,2,2-trideuterio-1-phenylethanol. InChIKey: WAPNOHKVXSQRPX-FIBGUPNXSA-N.

Identity
Molecular formulaC8H10O
Molecular weight125.18 g/mol
IUPAC name2,2,2-trideuterio-1-phenylethanol
InChIKeyWAPNOHKVXSQRPX-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])C(C1=CC=CC=C1)O

Computed by PubChem (NCBI)