CAS 219586-41-1 is the registry number for (±)-1-Phenylethanol-d10, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1,2,3,4,5-pentadeuterio-6-(1,2,2,2-tetradeuterio-1-deuteriooxyethyl)benzene (CAS 219586-41-1) is a chemical compound with the molecular formula C8H10O and a molecular weight of 132.23 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(1,2,2,2-tetradeuterio-1-deuteriooxyethyl)benzene. InChIKey: WAPNOHKVXSQRPX-NGOYZNFYSA-N.
| Molecular formula | C8H10O |
|---|---|
| Molecular weight | 132.23 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(1,2,2,2-tetradeuterio-1-deuteriooxyethyl)benzene |
| InChIKey | WAPNOHKVXSQRPX-NGOYZNFYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])(C([2H])([2H])[2H])O[2H])[2H])[2H] |
Computed by PubChem (NCBI)