Products 219586-41-1

CAS 219586-41-1 is the registry number for (±)-1-Phenylethanol-d10, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

1,2,3,4,5-pentadeuterio-6-(1,2,2,2-tetradeuterio-1-deuteriooxyethyl)benzene (CAS 219586-41-1) is a chemical compound with the molecular formula C8H10O and a molecular weight of 132.23 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(1,2,2,2-tetradeuterio-1-deuteriooxyethyl)benzene. InChIKey: WAPNOHKVXSQRPX-NGOYZNFYSA-N.

Identity
Molecular formulaC8H10O
Molecular weight132.23 g/mol
IUPAC name1,2,3,4,5-pentadeuterio-6-(1,2,2,2-tetradeuterio-1-deuteriooxyethyl)benzene
InChIKeyWAPNOHKVXSQRPX-NGOYZNFYSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])(C([2H])([2H])[2H])O[2H])[2H])[2H]

Computed by PubChem (NCBI)