Products 90162-45-1
CAS 90162-45-1 appears in our catalog under these names: (±)-1-Phenyl-d5-ethanol, (±)-1-Phenyl-d5-ethanol, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 5g, 1g.
1-(2,3,4,5,6-pentadeuteriophenyl)ethanol (CAS 90162-45-1) is a chemical compound with the molecular formula C8H10O and a molecular weight of 127.19 g/mol. IUPAC name: 1-(2,3,4,5,6-pentadeuteriophenyl)ethanol. InChIKey: WAPNOHKVXSQRPX-VIQYUKPQSA-N.
| Molecular formula | C8H10O |
|---|---|
| Molecular weight | 127.19 g/mol |
| IUPAC name | 1-(2,3,4,5,6-pentadeuteriophenyl)ethanol |
| InChIKey | WAPNOHKVXSQRPX-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C)O)[2H])[2H] |
Computed by PubChem (NCBI)