CAS 17543-17-8 appears in our catalog under these names: Z-L-Asp(tBu)-ONp, Z–Asp(OtBu)–ONp, Z-Asp(OtBu)-ONp, Z-Asp(OtBu)-ONp 98+%. Offered by: Creative Peptides, GLPBio, Biosynth, Ambeed. Available pack sizes: 5g, 100g, 25g, 50g.
4-O-tert-butyl 1-O-(4-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)butanedioate (CAS 17543-17-8) is a chemical compound with the molecular formula C22H24N2O8 and a molecular weight of 444.4 g/mol. IUPAC name: 4-O-tert-butyl 1-O-(4-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)butanedioate. InChIKey: KAURUWJRWPNSJD-SFHVURJKSA-N.
| Molecular formula | C22H24N2O8 |
|---|---|
| Molecular weight | 444.4 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-(4-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)butanedioate |
| InChIKey | KAURUWJRWPNSJD-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)