CAS 26048-69-1 is the registry number for Boc–Asp(OBzl)–ONp. Offered by: GLPBio. Available pack sizes: 100g, 25g.
4-O-benzyl 1-O-(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (CAS 26048-69-1) is a chemical compound with the molecular formula C22H24N2O8 and a molecular weight of 444.4 g/mol. IUPAC name: 4-O-benzyl 1-O-(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate. InChIKey: GKRBDGLUYWLXAX-SFHVURJKSA-N.
| Molecular formula | C22H24N2O8 |
|---|---|
| Molecular weight | 444.4 g/mol |
| IUPAC name | 4-O-benzyl 1-O-(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| InChIKey | GKRBDGLUYWLXAX-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OCC1=CC=CC=C1)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)