CAS 988-75-0 appears in our catalog under these names: Z-Glu-Tyr-OH, Z–Glu–Tyr–OH, Z-Glu-Tyr, Z-Glu-Tyr-OH, 99.17%, 99.17%, Z-Glu-Tyr-OH, 99.42%. Offered by: Creative Peptides, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 25g, 5g, 1g, 0,1g, 25mg, 50mg, 100mg.
(4S)-5-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid (CAS 988-75-0) is a chemical compound with the molecular formula C22H24N2O8 and a molecular weight of 444.4 g/mol. IUPAC name: (4S)-5-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: XLUMOZQZGPJGTL-ROUUACIJSA-N.
| Molecular formula | C22H24N2O8 |
|---|---|
| Molecular weight | 444.4 g/mol |
| IUPAC name | (4S)-5-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | XLUMOZQZGPJGTL-ROUUACIJSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)