CAS 1755-15-3 appears in our catalog under these names: 2–Acetyl–5,5–dimethyl–1,3–cyclohexanedione, 2-Acetyldimedone, 2-Acetyl-5,5-dimethyl-1,3-cyclohexanedione, >98.0%(GC), 2-Acetyl-5,5-dimethyl-1,3-cyclohexanedione 98%, 2-Acetyl-5,5-dimethylcyclohexane-1,3-dione, 98%, 98%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 0,025kg, 0,01kg, 0,05kg, 0,1kg, 250mg, 25g.
2-acetyl-5,5-dimethylcyclohexane-1,3-dione (CAS 1755-15-3) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: 2-acetyl-5,5-dimethylcyclohexane-1,3-dione. InChIKey: ITSKWKZDPHAQNK-UHFFFAOYSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2-acetyl-5,5-dimethylcyclohexane-1,3-dione |
| InChIKey | ITSKWKZDPHAQNK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1C(=O)CC(CC1=O)(C)C |
Computed by PubChem (NCBI)