Products 17556-38-6
CAS 17556-38-6 appears in our catalog under these names: 1–(3–Aminophenyl)–2,2,2–trifluoroethan–1–ol, 1-(3-Aminophenyl)-2,2,2-trifluoroethan-1-ol, 1-(3-Aminophenyl)-2,2,2-trifluoroethan-1-ol, 98%, 98%, 1-(3-Aminophenyl)-2,2,2-trifluoroethan-1-ol, 96%, 1-(3-Aminophenyl)-2,2,2-trifluoroethan-1-ol, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 50mg, 100mg.
1-(3-aminophenyl)-2,2,2-trifluoroethanol (CAS 17556-38-6) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: 1-(3-aminophenyl)-2,2,2-trifluoroethanol. InChIKey: VKCAHWLBIDYPNC-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 1-(3-aminophenyl)-2,2,2-trifluoroethanol |
| InChIKey | VKCAHWLBIDYPNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(C(F)(F)F)O |
Computed by PubChem (NCBI)