Products 17607-80-6

CAS 17607-80-6 is the registry number for 1-Benzyl-5-methyl-1h-pyrazole-3-carboxylate, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

1-benzyl-5-methylpyrazole-3-carboxylic acid (CAS 17607-80-6) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 1-benzyl-5-methylpyrazole-3-carboxylic acid. InChIKey: AIYMHQTUFQNZMJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12N2O2
Molecular weight216.24 g/mol
IUPAC name1-benzyl-5-methylpyrazole-3-carboxylic acid
InChIKeyAIYMHQTUFQNZMJ-UHFFFAOYSA-N
SMILESCC1=CC(=NN1CC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)