Products 176376-86-6

CAS 176376-86-6 is the registry number for 2-(3-Methyl-3-buten-1-yl)-1,3-diethyl Ester Propanedioic Acid. Offered by: TRC. Available pack sizes: 10g.

Structural formula: {0} (CAS {1})

Diethyl 2-(3-methylbut-3-enyl)propanedioate (CAS 176376-86-6) is a chemical compound with the molecular formula C12H20O4 and a molecular weight of 228.28 g/mol. IUPAC name: diethyl 2-(3-methylbut-3-enyl)propanedioate. InChIKey: XXFIWAJVJUCXKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20O4
Molecular weight228.28 g/mol
IUPAC namediethyl 2-(3-methylbut-3-enyl)propanedioate
InChIKeyXXFIWAJVJUCXKQ-UHFFFAOYSA-N
SMILESCCOC(=O)C(CCC(=C)C)C(=O)OCC

Computed by PubChem (NCBI)