Products 176543-45-6
CAS 176543-45-6 appears in our catalog under these names: L-Thr-NHMe hydrochloride, 96%, L-Threonine methyl amide hydrochloride, 97+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 100g, 25g, 1g.
(2S,3R)-2-amino-3-hydroxy-N-methylbutanamide;hydrochloride (CAS 176543-45-6) is a chemical compound with the molecular formula C5H13ClN2O2 and a molecular weight of 168.62 g/mol. IUPAC name: (2S,3R)-2-amino-3-hydroxy-N-methylbutanamide;hydrochloride. InChIKey: GJEQTLUMWKOAEW-HJXLNUONSA-N.
| Molecular formula | C5H13ClN2O2 |
|---|---|
| Molecular weight | 168.62 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-hydroxy-N-methylbutanamide;hydrochloride |
| InChIKey | GJEQTLUMWKOAEW-HJXLNUONSA-N |
| SMILES | C[C@H]([C@@H](C(=O)NC)N)O.Cl |
Computed by PubChem (NCBI)