Products 2483831-57-6
CAS 2483831-57-6 appears in our catalog under these names: L-Ornithine-2,3,3,4,4,5,5-d7 hydrochloride, >95% (HPLC), L-Ornithine-2,3,3,4,4,5,5-d7 HCl, 98 atom % D, min 98% Chemical Purity, L–Ornithine–d7 hydrochloride, L-Ornithine-d7 (hydrochloride), 99.90%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 5mg, 0,25g, 0,1g, 1mg, 25 mg, 50 mg.
(2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid;hydrochloride (CAS 2483831-57-6) is a chemical compound with the molecular formula C5H13ClN2O2 and a molecular weight of 175.66 g/mol. IUPAC name: (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid;hydrochloride. InChIKey: GGTYBZJRPHEQDG-AHQNDZJWSA-N.
| Molecular formula | C5H13ClN2O2 |
|---|---|
| Molecular weight | 175.66 g/mol |
| IUPAC name | (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid;hydrochloride |
| InChIKey | GGTYBZJRPHEQDG-AHQNDZJWSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C([2H])([2H])C([2H])([2H])N)N.Cl |
Computed by PubChem (NCBI)