Products 347841-40-1
CAS 347841-40-1 appears in our catalog under these names: L-Ornithine-d6 Hydrochloride, >95% (HPLC), L-ORNITHINE-3,3,4,4,5,5-D6 HYDROCHLORID&, L-Ornithine-d6 (hydrochloride), 99.2%. Offered by: TRC, Sigma-Aldrich, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 10MG, 5 mg, 1 mg, 10 mg.
(2S)-2,5-diamino-3,3,4,4,5,5-hexadeuteriopentanoic acid;hydrochloride (CAS 347841-40-1) is a chemical compound with the molecular formula C5H13ClN2O2 and a molecular weight of 174.66 g/mol. IUPAC name: (2S)-2,5-diamino-3,3,4,4,5,5-hexadeuteriopentanoic acid;hydrochloride. InChIKey: GGTYBZJRPHEQDG-IYAGNYDCSA-N.
| Molecular formula | C5H13ClN2O2 |
|---|---|
| Molecular weight | 174.66 g/mol |
| IUPAC name | (2S)-2,5-diamino-3,3,4,4,5,5-hexadeuteriopentanoic acid;hydrochloride |
| InChIKey | GGTYBZJRPHEQDG-IYAGNYDCSA-N |
| SMILES | [2H]C([2H])([C@@H](C(=O)O)N)C([2H])([2H])C([2H])([2H])N.Cl |
Computed by PubChem (NCBI)
Synonyms:
L-(3,3,4,4,5,5-~2~H_6_)Ornithine--hydrogen chloride (1/1), L-Ornithine-d6 Hydrochloride, L-Ornithine-d6 (hydrochloride), (2S)-2,5-diamino-3,3,4,4,5,5-hexadeuteriopentanoic acid;hydrochloride, (2S)-2,5-diamino(3,3,4,4,5,5-?H?)pentanoic acid hydrochloride, L-Ornithine-3,3,4,4,5,5-d6 hydrochloride, >=98 atom % D, >=98% (CP)