CAS 17672-28-5 appears in our catalog under these names: (4-Phenoxyphenyl)hydrazine 95+%, (4-Phenoxyphenyl)hydrazine, 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(4-phenoxyphenyl)hydrazine (CAS 17672-28-5) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: (4-phenoxyphenyl)hydrazine. InChIKey: LGRURSNANBXOMS-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | (4-phenoxyphenyl)hydrazine |
| InChIKey | LGRURSNANBXOMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)NN |
Computed by PubChem (NCBI)