CAS 176722-50-2 appears in our catalog under these names: 4-(tert-Butylamino)-1,1,1-trifluorobut-3-en-2-one, Z, 95%, 4-(tert-Butylamino)-1,1,1-trifluorobut-3-en-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
(E)-4-(tert-butylamino)-1,1,1-trifluorobut-3-en-2-one (CAS 176722-50-2) is a chemical compound with the molecular formula C8H12F3NO and a molecular weight of 195.18 g/mol. IUPAC name: (E)-4-(tert-butylamino)-1,1,1-trifluorobut-3-en-2-one. InChIKey: CUYARTGXSIEHIF-SNAWJCMRSA-N.
| Molecular formula | C8H12F3NO |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | (E)-4-(tert-butylamino)-1,1,1-trifluorobut-3-en-2-one |
| InChIKey | CUYARTGXSIEHIF-SNAWJCMRSA-N |
| SMILES | CC(C)(C)N/C=C/C(=O)C(F)(F)F |
Computed by PubChem (NCBI)