CAS 2133362-43-1 appears in our catalog under these names: 6-Amino-2-(trifluoromethyl)spiro(3.3)heptan-2-ol, 95%, 6-amino-2-(trifluoromethyl)spiro[3.3]heptan-2-ol, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
6-amino-2-(trifluoromethyl)spiro[3.3]heptan-2-ol (CAS 2133362-43-1) is a chemical compound with the molecular formula C8H12F3NO and a molecular weight of 195.18 g/mol. IUPAC name: 6-amino-2-(trifluoromethyl)spiro[3.3]heptan-2-ol. InChIKey: FRSUAPFITHYPTB-UHFFFAOYSA-N.
| Molecular formula | C8H12F3NO |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | 6-amino-2-(trifluoromethyl)spiro[3.3]heptan-2-ol |
| InChIKey | FRSUAPFITHYPTB-UHFFFAOYSA-N |
| SMILES | C1C(CC12CC(C2)(C(F)(F)F)O)N |
Computed by PubChem (NCBI)