Products 176850-21-8
CAS 176850-21-8 is the registry number for N-(tert-Butoxycarbonyl)aniline-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 1 mg, 5 mg, 10 mg.
Tert-butyl N-((1,2,3,4,5,6-13C6)cyclohexatrienyl)carbamate (CAS 176850-21-8) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 199.20 g/mol. IUPAC name: tert-butyl N-((1,2,3,4,5,6-13C6)cyclohexatrienyl)carbamate. InChIKey: KZZHPWMVEVZEFG-VFESMUGCSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | tert-butyl N-((1,2,3,4,5,6-13C6)cyclohexatrienyl)carbamate |
| InChIKey | KZZHPWMVEVZEFG-VFESMUGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 |
Computed by PubChem (NCBI)