CAS 17688-83-4 is the registry number for Policresulen Impurity 6. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2,5-ditert-butyl-4-methylphenol (CAS 17688-83-4) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: 2,5-ditert-butyl-4-methylphenol. InChIKey: AFTBJQDQENGCPC-UHFFFAOYSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | 2,5-ditert-butyl-4-methylphenol |
| InChIKey | AFTBJQDQENGCPC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)