CAS 17696-37-6 appears in our catalog under these names: 4-tert-Butyl-2,5-dimethylphenol, 95%, 4-(tert-Butyl)-2,5-dimethylphenol, 4-tert-Butyl-2,5-dimethylphenol, >95%, >95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 50mg, 0,5g, 100mg, 250mg.
4-tert-butyl-2,5-dimethylphenol (CAS 17696-37-6) is a chemical compound with the molecular formula C12H18O and a molecular weight of 178.27 g/mol. IUPAC name: 4-tert-butyl-2,5-dimethylphenol. InChIKey: ZSPDNAYHQYQUPC-UHFFFAOYSA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 178.27 g/mol |
| IUPAC name | 4-tert-butyl-2,5-dimethylphenol |
| InChIKey | ZSPDNAYHQYQUPC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1O)C)C(C)(C)C |
Computed by PubChem (NCBI)