CAS 17701-61-0 appears in our catalog under these names: Benzyl 3–hydroxy–2,2–dimethylpropanoate, Benzyl 3-hydroxy-2,2-dimethylpropanoate, Benzyl 3-hydroxy-2,2-dimethylpropanoate 97%, Benzyl 3-hydroxy-2,2-dimethylpropanoate, 97%, 97%, Benzyl 3-hydroxy-2,2-dimethylpropanoate, 96%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 250mg, 50g, 500mg, 2.5g.
Benzyl 3-hydroxy-2,2-dimethylpropanoate (CAS 17701-61-0) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: benzyl 3-hydroxy-2,2-dimethylpropanoate. InChIKey: PLZZXRKTRWITII-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | benzyl 3-hydroxy-2,2-dimethylpropanoate |
| InChIKey | PLZZXRKTRWITII-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)