CAS 1771689-24-7 is the registry number for 4,4′-(2,5-Diethynyl-1,4-phenylene)bis[benzoic acid], 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[4-(4-carboxyphenyl)-2,5-diethynylphenyl]benzoic acid (CAS 1771689-24-7) is a chemical compound with the molecular formula C24H14O4 and a molecular weight of 366.4 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)-2,5-diethynylphenyl]benzoic acid. InChIKey: VQIGWQOTUFHRFC-UHFFFAOYSA-N.
| Molecular formula | C24H14O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 4-[4-(4-carboxyphenyl)-2,5-diethynylphenyl]benzoic acid |
| InChIKey | VQIGWQOTUFHRFC-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=C(C=C1C2=CC=C(C=C2)C(=O)O)C#C)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)