CAS 177364-98-6 appears in our catalog under these names: 3,4-Dihydro-2H-thieno[3,4-b][1,4]dioxepine-6,8-dicarboxylic acid, 98%, 98%, 3,4–Dihydro–2H–thieno(3,4–b)(1,4)dioxepine–6,8–dicarboxylic acid, 3,4-Dihydro-2H-thieno[3,4-b][1,4]dioxepine-6,8-dicarboxylic acid, 98%. Offered by: Chemat, GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g.
3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine-6,8-dicarboxylic acid (CAS 177364-98-6) is a chemical compound with the molecular formula C9H8O6S and a molecular weight of 244.22 g/mol. IUPAC name: 3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine-6,8-dicarboxylic acid. InChIKey: MCLQXEPXGNPDHG-UHFFFAOYSA-N.
| Molecular formula | C9H8O6S |
|---|---|
| Molecular weight | 244.22 g/mol |
| IUPAC name | 3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine-6,8-dicarboxylic acid |
| InChIKey | MCLQXEPXGNPDHG-UHFFFAOYSA-N |
| SMILES | C1COC2=C(SC(=C2OC1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)