Products 2219380-12-6
CAS 2219380-12-6 is the registry number for 5-(1,3-Dioxolan-2-yl)thiophene-2,3-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(1,3-dioxolan-2-yl)thiophene-2,3-dicarboxylic acid (CAS 2219380-12-6) is a chemical compound with the molecular formula C9H8O6S and a molecular weight of 244.22 g/mol. IUPAC name: 5-(1,3-dioxolan-2-yl)thiophene-2,3-dicarboxylic acid. InChIKey: VOJLSCNOVZNTKQ-UHFFFAOYSA-N.
| Molecular formula | C9H8O6S |
|---|---|
| Molecular weight | 244.22 g/mol |
| IUPAC name | 5-(1,3-dioxolan-2-yl)thiophene-2,3-dicarboxylic acid |
| InChIKey | VOJLSCNOVZNTKQ-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(S2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)