CAS 1795140-39-4 is the registry number for p-Coumaric Acid-d4 4-O-Sulfate. Offered by: TRC. Available pack sizes: 10mg.
(E)-3-(2,3,5,6-tetradeuterio-4-sulfooxyphenyl)prop-2-enoic acid (CAS 1795140-39-4) is a chemical compound with the molecular formula C9H8O6S and a molecular weight of 248.25 g/mol. IUPAC name: (E)-3-(2,3,5,6-tetradeuterio-4-sulfooxyphenyl)prop-2-enoic acid. InChIKey: OYDCCWNLILCHDJ-NTDOOMOHSA-N.
| Molecular formula | C9H8O6S |
|---|---|
| Molecular weight | 248.25 g/mol |
| IUPAC name | (E)-3-(2,3,5,6-tetradeuterio-4-sulfooxyphenyl)prop-2-enoic acid |
| InChIKey | OYDCCWNLILCHDJ-NTDOOMOHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1/C=C/C(=O)O)[2H])[2H])OS(=O)(=O)O)[2H] |
Computed by PubChem (NCBI)