CAS 1774893-01-4 appears in our catalog under these names: 4,6-Dimethoxy-1H-indole-2-carbaldehyde, 97%, 4,6-Dimethoxy-1H-indole-2-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
4,6-dimethoxy-1H-indole-2-carbaldehyde (CAS 1774893-01-4) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 4,6-dimethoxy-1H-indole-2-carbaldehyde. InChIKey: BURHYVFYBWIDKH-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 4,6-dimethoxy-1H-indole-2-carbaldehyde |
| InChIKey | BURHYVFYBWIDKH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C(N2)C=O)C(=C1)OC |
Computed by PubChem (NCBI)