CAS 177540-63-5 is the registry number for {((Methylsulfanyl)methanethioyl)amino}(1-phenylethylidene)amine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Methyl N-[(E)-1-phenylethylideneamino]carbamodithioate (CAS 177540-63-5) is a chemical compound with the molecular formula C10H12N2S2 and a molecular weight of 224.4 g/mol. IUPAC name: methyl N-[(E)-1-phenylethylideneamino]carbamodithioate. InChIKey: DAMFAIOELYWARL-DHZHZOJOSA-N.
| Molecular formula | C10H12N2S2 |
|---|---|
| Molecular weight | 224.4 g/mol |
| IUPAC name | methyl N-[(E)-1-phenylethylideneamino]carbamodithioate |
| InChIKey | DAMFAIOELYWARL-DHZHZOJOSA-N |
| SMILES | C/C(=N\NC(=S)SC)/C1=CC=CC=C1 |
Computed by PubChem (NCBI)