CAS 1823404-61-0 is the registry number for 1,2-Di(thiophen-2-yl)ethane-1,2-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-dithiophen-2-ylethane-1,2-diamine (CAS 1823404-61-0) is a chemical compound with the molecular formula C10H12N2S2 and a molecular weight of 224.4 g/mol. IUPAC name: 1,2-dithiophen-2-ylethane-1,2-diamine. InChIKey: QOYHIHWLSZYWFP-UHFFFAOYSA-N.
| Molecular formula | C10H12N2S2 |
|---|---|
| Molecular weight | 224.4 g/mol |
| IUPAC name | 1,2-dithiophen-2-ylethane-1,2-diamine |
| InChIKey | QOYHIHWLSZYWFP-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(C(C2=CC=CS2)N)N |
Computed by PubChem (NCBI)