CAS 931626-97-0 is the registry number for 4-(2,5-Dimethylthiophen-3-yl)-N-methylthiazol-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,5-dimethylthiophen-3-yl)-N-methyl-1,3-thiazol-2-amine (CAS 931626-97-0) is a chemical compound with the molecular formula C10H12N2S2 and a molecular weight of 224.4 g/mol. IUPAC name: 4-(2,5-dimethylthiophen-3-yl)-N-methyl-1,3-thiazol-2-amine. InChIKey: AVPLAARFVZNNNF-UHFFFAOYSA-N.
| Molecular formula | C10H12N2S2 |
|---|---|
| Molecular weight | 224.4 g/mol |
| IUPAC name | 4-(2,5-dimethylthiophen-3-yl)-N-methyl-1,3-thiazol-2-amine |
| InChIKey | AVPLAARFVZNNNF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)C)C2=CSC(=N2)NC |
Computed by PubChem (NCBI)