CAS 177611-35-7 is the registry number for Benzyl isopropyl(3-(2-nitrophenyl)-3-oxopropyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[3-(2-nitrophenyl)-3-oxopropyl]-N-propan-2-ylcarbamate (CAS 177611-35-7) is a chemical compound with the molecular formula C20H22N2O5 and a molecular weight of 370.4 g/mol. IUPAC name: benzyl N-[3-(2-nitrophenyl)-3-oxopropyl]-N-propan-2-ylcarbamate. InChIKey: PKBRGRUHMWLSNK-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O5 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | benzyl N-[3-(2-nitrophenyl)-3-oxopropyl]-N-propan-2-ylcarbamate |
| InChIKey | PKBRGRUHMWLSNK-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCC(=O)C1=CC=CC=C1[N+](=O)[O-])C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)