CAS 2365-53-9 appears in our catalog under these names: Ac-phe-tyr-oh, 95%, Ac–Phe–Tyr–OH, Ac-Phe-Tyr-OH, ≥98%, ≥98%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (CAS 2365-53-9) is a chemical compound with the molecular formula C20H22N2O5 and a molecular weight of 370.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid. InChIKey: AGHAPAFOMGHXMT-ROUUACIJSA-N.
| Molecular formula | C20H22N2O5 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | AGHAPAFOMGHXMT-ROUUACIJSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)