CAS 2768-53-8 appears in our catalog under these names: Z-Ala-phe-oh, 98%, Z–Ala–Phe–OH, Z-Ala-Phe-OH, 98%,RG, 98%,RG. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 25g, 1g, 250mg.
(2S)-3-phenyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid (CAS 2768-53-8) is a chemical compound with the molecular formula C20H22N2O5 and a molecular weight of 370.4 g/mol. IUPAC name: (2S)-3-phenyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid. InChIKey: BVNXQVWGWUHKMK-YOEHRIQHSA-N.
| Molecular formula | C20H22N2O5 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | (2S)-3-phenyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
| InChIKey | BVNXQVWGWUHKMK-YOEHRIQHSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)