Products 17762-92-4
CAS 17762-92-4 appears in our catalog under these names: N-Isopropylbutylone Hydrochloride, 3,4–Methylenedioxy–α–Isopropylaminobutiophenone (hydrochloride). Offered by: TRC, GLPBio. Available pack sizes: 100mg, 1mg, 5mg.
1-(1,3-benzodioxol-5-yl)-2-(propan-2-ylamino)butan-1-one;hydrochloride (CAS 17762-92-4) is a chemical compound with the molecular formula C14H20ClNO3 and a molecular weight of 285.76 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-(propan-2-ylamino)butan-1-one;hydrochloride. InChIKey: KBDHLVCIWNNCSP-UHFFFAOYSA-N.
| Molecular formula | C14H20ClNO3 |
|---|---|
| Molecular weight | 285.76 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-(propan-2-ylamino)butan-1-one;hydrochloride |
| InChIKey | KBDHLVCIWNNCSP-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)C1=CC2=C(C=C1)OCO2)NC(C)C.Cl |
Computed by PubChem (NCBI)