CAS 17763-12-1 appears in our catalog under these names: 2-(Dimethylamino)-3',4'-(methylenedioxy)butyrophenone Hydrochloride, Dibutylone Hydrochloride (bk-MMBDB HCl), Dibutylone Hydrochloride (bk-MMBDB HCl) 1.0 mg/ml in Methanol (as free base). Offered by: TRC, LoGiCal. Available pack sizes: 50mg, 10mg, 1ml.
1-(1,3-benzodioxol-5-yl)-2-(dimethylamino)butan-1-one;hydrochloride (CAS 17763-12-1) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-(dimethylamino)butan-1-one;hydrochloride. InChIKey: LLAFASVUPHWNTH-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-(dimethylamino)butan-1-one;hydrochloride |
| InChIKey | LLAFASVUPHWNTH-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)C1=CC2=C(C=C1)OCO2)N(C)C.Cl |
Computed by PubChem (NCBI)