CAS 17763-13-2 appears in our catalog under these names: N-Methyl Pentylone, Dipentylone hydrochloride, N,N-DIMETHYLPENTYLONE HCL. Offered by: TRC, Biosynth, Sigma-Aldrich. Available pack sizes: 250mg, 25mg, 50mg, 100mg, 1ML.
1-(1,3-benzodioxol-5-yl)-2-(dimethylamino)pentan-1-one;hydrochloride (CAS 17763-13-2) is a chemical compound with the molecular formula C14H20ClNO3 and a molecular weight of 285.76 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-(dimethylamino)pentan-1-one;hydrochloride. InChIKey: LSDMAZIZKMMYTB-UHFFFAOYSA-N.
| Molecular formula | C14H20ClNO3 |
|---|---|
| Molecular weight | 285.76 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-(dimethylamino)pentan-1-one;hydrochloride |
| InChIKey | LSDMAZIZKMMYTB-UHFFFAOYSA-N |
| SMILES | CCCC(C(=O)C1=CC2=C(C=C1)OCO2)N(C)C.Cl |
Computed by PubChem (NCBI)