CAS 17764-18-0 appears in our catalog under these names: 3,4-Methylenedioxy-N-ethylbuphedrone Hydrochloride, Eutylone Hydrochloride (1-(3,4-Methylene-dioxyphenyl)-2-ethylamino-butan-1-one Hydrochloride), Eutylone Hydrochloride (1-(3,4-Methylenedioxyphenyl)-2-ethylamino-butan-1-one Hydrochloride) 1.0 mg/ml in Methanol (as free base), Eutylone (hydrochloride), Eutylone hydrochloride solution. Offered by: TRC, LoGiCal, GLPBio, Biosynth. Available pack sizes: 50mg, 10mg, 1ml, 1mg, 5mg, 25mg.
1-(1,3-benzodioxol-5-yl)-2-(ethylamino)butan-1-one;hydrochloride (CAS 17764-18-0) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-(ethylamino)butan-1-one;hydrochloride. InChIKey: LZTAJXOEHCOKDE-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-(ethylamino)butan-1-one;hydrochloride |
| InChIKey | LZTAJXOEHCOKDE-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)C1=CC2=C(C=C1)OCO2)NCC.Cl |
Computed by PubChem (NCBI)