Products 2119948-16-0
CAS 2119948-16-0 is the registry number for Eutylone-d5 Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
1-(1,3-benzodioxol-5-yl)-2-(1,1,2,2,2-pentadeuterioethylamino)butan-1-one;hydrochloride (CAS 2119948-16-0) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 276.77 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-(1,1,2,2,2-pentadeuterioethylamino)butan-1-one;hydrochloride. InChIKey: LZTAJXOEHCOKDE-CIIWIYAOSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 276.77 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-(1,1,2,2,2-pentadeuterioethylamino)butan-1-one;hydrochloride |
| InChIKey | LZTAJXOEHCOKDE-CIIWIYAOSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NC(CC)C(=O)C1=CC2=C(C=C1)OCO2.Cl |
Computed by PubChem (NCBI)