CAS 177702-21-5 appears in our catalog under these names: (R)-1-Boc-4-(aminocarboxymethyl)piperidine, 97%, (R)-2-Amino-2-(1-(tert-butoxycarbonyl)piperidin-4-yl)acetic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
(2R)-2-amino-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid (CAS 177702-21-5) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: (2R)-2-amino-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid. InChIKey: UPEUKKCILASJSH-SECBINFHSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | (2R)-2-amino-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid |
| InChIKey | UPEUKKCILASJSH-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)