Products 17777-31-0

CAS 17777-31-0 is the registry number for 6-Phenylhexanenitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

6-phenylhexanenitrile (CAS 17777-31-0) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: 6-phenylhexanenitrile. InChIKey: BSJKBXNHLQEFMG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15N
Molecular weight173.25 g/mol
IUPAC name6-phenylhexanenitrile
InChIKeyBSJKBXNHLQEFMG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCCCCC#N

Computed by PubChem (NCBI)