CAS 17781-16-7 appears in our catalog under these names: Carbofuranphenol-3-keto,50mg,neat, 95%, Carbofuranphenol-3-keto, >95% (HPLC), Carbofuranphenol-3-keto. Offered by: Chemat Brand, TRC, HPC Standards. Available pack sizes: on request, 1mg, 2,5mg, 5mg, 1x10mg.
7-hydroxy-2,2-dimethyl-1-benzofuran-3-one (CAS 17781-16-7) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 7-hydroxy-2,2-dimethyl-1-benzofuran-3-one. InChIKey: XLZCZWCXCBPEJR-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 7-hydroxy-2,2-dimethyl-1-benzofuran-3-one |
| InChIKey | XLZCZWCXCBPEJR-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)C2=C(O1)C(=CC=C2)O)C |
Computed by PubChem (NCBI)