CAS 17782-03-5 is the registry number for 2-Acetamidonicotinic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-acetamidopyridine-3-carboxylic acid (CAS 17782-03-5) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 2-acetamidopyridine-3-carboxylic acid. InChIKey: KRKPMLZTPRQPTR-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2-acetamidopyridine-3-carboxylic acid |
| InChIKey | KRKPMLZTPRQPTR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC=N1)C(=O)O |
Computed by PubChem (NCBI)