CAS 17784-47-3 appears in our catalog under these names: Acridine hydrochloride, 98%, Acridine hydrochloride, Acridine Hydrochloride, >98.0%(HPLC)(T), Acridine hydrochloride, Acridine hydrochloride, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g.
Acridine;hydrochloride (CAS 17784-47-3) is a chemical compound with the molecular formula C13H10ClN and a molecular weight of 215.68 g/mol. IUPAC name: acridine;hydrochloride. InChIKey: XUESTGHCVFYOLL-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN |
|---|---|
| Molecular weight | 215.68 g/mol |
| IUPAC name | acridine;hydrochloride |
| InChIKey | XUESTGHCVFYOLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=N2.Cl |
Computed by PubChem (NCBI)