CAS 2502-99-0 is the registry number for 4-((1Z)-2-(4-Chlorophenyl)vinyl)pyridine. Offered by: Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 100mg.
4-[(Z)-2-(4-chlorophenyl)ethenyl]pyridine (CAS 2502-99-0) is a chemical compound with the molecular formula C13H10ClN and a molecular weight of 215.68 g/mol. IUPAC name: 4-[(Z)-2-(4-chlorophenyl)ethenyl]pyridine. InChIKey: PONMZBJRRLHVPF-UPHRSURJSA-N.
| Molecular formula | C13H10ClN |
|---|---|
| Molecular weight | 215.68 g/mol |
| IUPAC name | 4-[(Z)-2-(4-chlorophenyl)ethenyl]pyridine |
| InChIKey | PONMZBJRRLHVPF-UPHRSURJSA-N |
| SMILES | C1=CC(=CC=C1/C=C\C2=CC=NC=C2)Cl |
Computed by PubChem (NCBI)