Products 4903-36-0
CAS 4903-36-0 is the registry number for N-Phenyl-benzimidoyl chloride. Offered by: Chemat. Available pack sizes: 1g, 2500mg, 25g.
N-phenylbenzenecarboximidoyl chloride (CAS 4903-36-0) is a chemical compound with the molecular formula C13H10ClN and a molecular weight of 215.68 g/mol. IUPAC name: N-phenylbenzenecarboximidoyl chloride. InChIKey: WFOFSUPMQDLYOM-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN |
|---|---|
| Molecular weight | 215.68 g/mol |
| IUPAC name | N-phenylbenzenecarboximidoyl chloride |
| InChIKey | WFOFSUPMQDLYOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=NC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
N-PHENYLBENZIMIDOYL CHLORIDE, N-Phenyl-benzimidoyl chloride, N-phenylbenzenecarboximidoyl chloride, N-PHENYLBENZENECARBONIMIDOYL CHLORIDE, TimTec1_000480, N-phenylbenzoimidoyl chloride, NCIOpen2_006592, N-PHENYLBENZIMIDOYLCHLORIDE, WFOFSUPMQDLYOM-UHFFFAOYSA-N, N-Phenylbenzimidoyl chloride, 95%