Products 1778948-18-7

CAS 1778948-18-7 is the registry number for 3-(4-Chloro-2-fluorophenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(4-chloro-2-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1778948-18-7) is a chemical compound with the molecular formula C11H7ClFNO3 and a molecular weight of 255.63 g/mol. IUPAC name: 3-(4-chloro-2-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: FUXMBKYGMROOKR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7ClFNO3
Molecular weight255.63 g/mol
IUPAC name3-(4-chloro-2-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid
InChIKeyFUXMBKYGMROOKR-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C2=C(C=C(C=C2)Cl)F)C(=O)O

Computed by PubChem (NCBI)